On Target MTOR_HUMAN 0.3313253/CHEMBL371029
For the given ligand MIe-421, we have found in our database that, being scored 0.3313253, the most similar ligand is CHEMBL371029. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL371029 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CO[C@H]1C[C@@H]2CC[C@@H](C)[C@@](O)(O2)C(=O)C(=O)N3CCCC[C@H]3C(=O)N[C@H](CCc4ccccc4)C(=O)NCC(=O)N(C)CC(=O)O[C@H]1C |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00010040 01007200 0010050a 84010700 802c00c0 00200000 00000800 20000048 04102800 010808e0 08302000 5001f000 1600800a 02a82001 80101008 082d1008 10a20000 82000000 11c02000 00000201 00000120 38040e10 17000083 0a50001c 10000401 80000000 00800000 30000021 08000200 0006000b 20a24000 00402600 |