On Target FYN_HUMAN 0.39423078/CHEMBL1975923
For the given ligand MIe-421, we have found in our database that, being scored 0.39423078, the most similar ligand is CHEMBL1975923. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL1975923 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(CCC(=O)O)(c1ccc(O)c(N)c1)c2ccc(O)c(N)c2 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 08010002 01000008 20000102 00010200 00080000 00000000 02000000 01000000 00400800 00080840 08100004 40009000 04008002 00200800 00000040 00084008 00000000 02000000 00400000 00020001 40000100 08000a00 21000000 00400010 00040000 a0000000 00120000 40000000 00400080 00060002 00000000 00400400 |