On Target ESR1_HUMAN 0.5945946/CHEMBL235828
For the given ligand MIe-421, we have found in our database that, being scored 0.5945946, the most similar ligand is CHEMBL235828. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL235828 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | Oc1ccc(cc1)[C@H]2Oc3ccc(O)cc3[C@H]4CCC(=O)C[C@@H]24 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04050000 43000018 2000010a 00010300 00081000 c2004000 02000000 00000200 00000900 00080840 08100000 40009040 0480800a 00a10000 11000001 020a2008 00800000 22008100 02402000 00020201 00000100 08000220 01000040 00c01410 00004000 c0002000 005a0000 00000000 00000302 00024002 40020000 02400400 |