On Target PTGES_HUMAN 0.39634147/CHEMBL3608368
For the given ligand MIe-421, we have found in our database that, being scored 0.39634147, the most similar ligand is CHEMBL3608368. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL3608368 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CCCCCC(=O)c1c(O)c(C(C(C)C)C2=C(O)C(C)(C)C(=O)C(C)(C)C2=O)c(O)c3C(C(C)C)C4=C(Oc13)C(C)(C)C(=O)C(C)(C)C4=O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04010001 01000808 2080010b 0021030a 00081801 82a20000 460400c1 00000602 01060948 00988a40 08900000 40009060 9482802a 00a00000 13000401 08082008 00800600 22108020 00652008 0a020801 00000100 18020288 01008020 0c480414 00200800 d0000000 00525800 80800000 00014302 80024002 a4060000 00000400 |