On Target MIF_HUMAN 0.3112583/CHEMBL497598
For the given ligand MIe-421, we have found in our database that, being scored 0.3112583, the most similar ligand is CHEMBL497598. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL497598 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)(C)OC(=O)C[C@H]1CC(=NO1)c2ccc(O)c(F)c2 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00010000 01000008 20900102 02050b00 02080040 10440010 02000040 00002000 00108948 03092851 08110000 50009000 9400880a 00a01000 00000008 00091018 00820800 02000000 01406000 00860441 00000120 28008a00 01001042 00400010 00000400 80020004 e0120000 02000001 0010420a 00028002 40080000 00000600 |