On Target NMDE1_HUMAN 0.21538462/CHEMBL284237
For the given ligand MIe-421, we have found in our database that, being scored 0.21538462, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |