On Target TRPV1_RAT 0.29457363/CHEMBL1940203
For the given ligand Nai, we have found in our database that, being scored 0.29457363, the most similar ligand is CHEMBL1940203. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL1940203 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CC(C(=O)NCc1ccc(cc1)C2CCC=C2)c3ccc(NS(=O)(=O)C)c(F)c3 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000002 01800800 00100102 42310600 00000000 00c00010 00000001 02001402 00000980 00982840 08302004 50009800 81008c02 00201001 c0080440 00020000 00000400 12100000 00200000 00004a01 c0000100 18208e00 20008000 81400018 00000084 c0202000 80400000 8000000d 04200100 00068003 24042000 00010660 |