On Target FABP5_HUMAN 0.20833333/CHEMBL8659
For the given ligand Nai, we have found in our database that, being scored 0.20833333, the most similar ligand is CHEMBL8659. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL8659 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CCCCCCCC\C=C/CCCCCCCC(=O)O |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00010000 01000000 00000000 00000000 00080000 00000000 00000000 00000402 00000000 00100000 00000000 40001000 04028008 00800000 00000400 00080008 00000000 00000000 00402000 00000001 00000000 00000a00 01008000 00000010 00200000 00000000 00404000 80000000 00000000 00000000 24020000 00000000 |