On Target AMPN_HUMAN 0.3382353/CHEMBL414393
For the given ligand Nai, we have found in our database that, being scored 0.3382353, the most similar ligand is CHEMBL414393. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL414393 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | NC(CS)Cc1ccccc1 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 00000000 00000100 00110600 00000000 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00040000 00000000 00000000 00000000 02000000 00000000 00000001 20000100 18000000 00000100 81400010 00000000 80000000 00000000 00000000 04000000 00060012 00000000 03010400 |