On Target PPARG_HUMAN 0.5301205/CHEMBL75133
For the given ligand Nai, we have found in our database that, being scored 0.5301205, the most similar ligand is CHEMBL75133. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL75133 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | C\C(=C/C(=O)O)\C=C\[C@@H]1C[C@]1(C)c2ccc3c(c2)C(C)(C)CCC3(C)C |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 01040000 00000102 00110200 40000001 00000003 00000000 00000403 01000900 00180842 08100000 40008800 00028000 21220000 00000400 0008000c 00000200 02000000 00092090 00000001 00000100 08000a00 0140c000 00400012 00201000 80002001 00404000 80800000 00000002 00020002 04000000 00010400 |