On Target PDE4B_HUMAN 0.24832214/CHEMBL313041
For the given ligand Nai, we have found in our database that, being scored 0.24832214, the most similar ligand is CHEMBL313041. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL313041 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | COc1ccc(cc1OC)C2=NNC(=O)C3CC=CCC23 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 0081000c 43000008 2000010a 00010e80 02401000 40000800 02040001 01016402 10100900 001888c1 08110018 40099004 8402c002 20200008 01000481 00088008 00000000 02001020 10092400 02820a01 80080100 18000600 40048002 08400010 00200000 80402880 40524000 80000040 0400020b 800f020a 64200000 00408400 |