On Target ACM4_HUMAN 0.36734694/CHEMBL3085495
For the given ligand Nai, we have found in our database that, being scored 0.36734694, the most similar ligand is CHEMBL3085495. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL3085495 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | OC(CCN1CCCCC1)([C@H]2C[C@H]3C[C@@H]2C=C3)c4ccccc4 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 81000200 00100102 00010600 00080000 00004000 00000000 20000402 00000900 001808c8 08300000 50018000 00020002 00a00000 00000400 000c0008 00000000 02000020 00c02000 00002201 00000100 18000030 01008080 00500010 00200001 80202000 00404000 90000000 00000002 0106000a 64020000 00002600 |