On Target NEP_HUMAN 0.31034482/CHEMBL4100250
For the given ligand Nai, we have found in our database that, being scored 0.31034482, the most similar ligand is CHEMBL4100250. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL4100250 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | OC(=O)C(CC(=O)C(S)Cc1ccccc1)Cc2ccccc2 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00050000 01000000 00000102 00110200 00080008 00000000 00000000 00000000 00a00800 01090840 08100000 40029000 04008008 00a40000 00000000 00080008 00000000 02000000 00402008 00000001 00000100 08000a00 01000140 02400010 00000800 80000000 00000000 00000040 00000002 00020002 00020000 01410400 |