On Target HPGDS_HUMAN 0.21084337/CHEMBL3698265
For the given ligand Nai, we have found in our database that, being scored 0.21084337, the most similar ligand is CHEMBL3698265. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL3698265 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CC1C=CC=C1C(=O)N2CCN(CC2)C(=O)NC3CCN(CC3)c4ccc(CCCn5ccnn5)cc4 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00004002 0104be18 60100100 44010e00 60080000 00002001 04100004 20002408 11100800 101a09e0 08340004 50019800 0402b006 2081a000 00020240 000c000c 20044010 02000100 084900c0 02041201 60120100 38090610 61009021 02500818 00210000 80000000 00480000 90000080 0c008000 800e001b 04100000 04008600 |