On Target ALDR_HUMAN 0.26595744/CHEMBL129795
For the given ligand Nai, we have found in our database that, being scored 0.26595744, the most similar ligand is CHEMBL129795. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL129795 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | Oc1ccc(\C=C\C(=O)c2ccc(O)cc2O)cc1 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000001 00000808 20000301 00010202 00000000 00820000 82000081 00000600 01840000 00b80840 08000000 40008000 00008002 00000000 00000002 00002008 00000400 02100000 00018000 00020800 00000000 08020200 00008001 00400014 01000000 80000000 00522000 40000000 00400000 00020002 84000000 00000400 |