On Target AGTR2_HUMAN 0.20634921/CHEMBL128416
For the given ligand Nai, we have found in our database that, being scored 0.20634921, the most similar ligand is CHEMBL128416. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL128416 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | OC(=O)C1Cc2ccccc2CN1C(=O)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00008008 00805000 00100100 10010600 000000a0 00000000 01001000 03001004 00000880 00080840 08300000 4000b000 07008882 00200000 c0080480 00080008 10000200 02000020 00400008 00000201 80020100 18208e00 03004040 81400018 00000800 e0000001 00004000 c0000000 04000180 00860003 20046000 00002600 |