On Target OPRM_MOUSE 0.29411766/CHEMBL146248
For the given ligand Nai, we have found in our database that, being scored 0.29411766, the most similar ligand is CHEMBL146248. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL146248 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CC1C2Cc3ccc(O)cc3[C@@]1(C)CCN2CCCCC=C |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 43000208 20100102 00010600 00000020 40000002 02000000 20000401 00000880 001808c0 08300000 50818000 00000002 00200000 00000420 02040008 00000200 02000000 00012000 00020201 00000100 18200010 00004000 81500010 00000000 80000001 00120000 90000000 04000002 0006000a 04020000 00002600 |