On Target NOS2_HUMAN 0.30379745/CHEMBL450583
For the given ligand Nai, we have found in our database that, being scored 0.30379745, the most similar ligand is CHEMBL450583. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL450583 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | Br.CCC(NC(=N)C)c1ccccc1 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 00000000 00100100 00010600 00000000 00000000 00000000 02001000 00000a00 00080853 08300000 40008000 00000802 00000000 00000400 00100000 00000000 02000000 00000000 00000201 00000100 18008000 00000000 00400010 00000000 c0000000 40000000 90000000 00000110 00060002 00040008 00000600 |