On Target CXCR1_HUMAN 0.25274727/CHEMBL191413
For the given ligand Nai, we have found in our database that, being scored 0.25274727, the most similar ligand is CHEMBL191413. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL191413 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(=O)(=O)C |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000040 20000000 00000100 01310600 00000000 00000000 00010000 00001000 00000900 00480840 08102000 40009800 01008001 00000001 c0000000 00000000 02000000 02000000 00000000 00004001 00000100 18000600 00000000 91400010 02000000 80000000 00000000 0000000c 04000000 00060002 00002000 00010660 |