On Target DRD4_HUMAN 0.3063063/CHEMBL335545
For the given ligand Nai, we have found in our database that, being scored 0.3063063, the most similar ligand is CHEMBL335545. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL335545 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | C([C@@H]1CCC=C(C1)c2ccccc2)N3CCC(=CC3)c4ccccc4 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000010 09008200 00100302 00010600 00000000 00000000 80180080 20000402 10100800 005808c8 08300000 40018000 00020102 00210000 00000402 00040000 20004400 02000160 00012002 00800201 00000100 18000000 00008020 00500010 01200000 80000000 00486000 d0010000 04400002 0006040a 04020000 02002600 |