On Target PGH2_HUMAN 0.4574468/CHEMBL92443
For the given ligand Nai, we have found in our database that, being scored 0.4574468, the most similar ligand is CHEMBL92443. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL92443 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CC1(C)C(=C)C(=C1c2ccc(cc2)S(=O)(=O)C)c3ccccc3 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 01841200 00020302 00910200 40000000 00800001 80000081 00000500 00000800 00180842 08102100 60008000 00020000 00210000 80200002 00000000 04000400 02100000 40002000 00022001 80000111 18040000 00808020 08400819 01000000 80000000 00402000 c0000020 00400002 00020002 04000000 01010420 |