On Target 5HT1B_HUMAN 0.29761904/CHEMBL146942
For the given ligand Nai, we have found in our database that, being scored 0.29761904, the most similar ligand is CHEMBL146942. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL146942 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | NCCCC1(CCCN)CCc2cccc(O)c2C1 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 43000008 20000102 00010600 00000000 40000002 02000000 00000201 00000800 000808c0 08100000 40018040 00000002 00200000 00000020 00002008 00000200 02000000 00002000 00020201 00000100 18000010 00004000 00400010 00000000 80000001 00000000 00000000 00000002 00064002 00020000 00000400 |