On Target TLR4_HUMAN 0.20143884/CHEMBL4071705
For the given ligand Nai, we have found in our database that, being scored 0.20143884, the most similar ligand is CHEMBL4071705. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL4071705 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | C[C@@H](OC(=O)c1ccccc1O)[C@]2(O)CC[C@]3(O)[C@]4(O)CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4C[C@@H](OC(=O)\C=C\c6ccccc6)[C@]23C |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00040000 81000808 a0000d00 00010300 00280050 00024000 82000080 00000c02 01800100 01100848 40000200 40008000 04028002 02810000 00000406 02083008 00820c00 02000020 3341a018 00022001 00000020 28020a20 05008000 08400014 00201400 80002000 00486000 c0000420 00400200 0102000a e4020000 02000010 |