On Target MTOR_HUMAN 0.23312883/CHEMBL411735
For the given ligand Nai, we have found in our database that, being scored 0.23312883, the most similar ligand is CHEMBL411735. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL411735 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | CO[C@H]1C[C@@H](C)C\C(=C\[C@@H](CC=C)C(=O)C[C@H](O)[C@@H](C)[C@H](OC(=O)C2CCCCN2C(=O)C(=O)[C@]3(O)CC1[C@H](C[C@H]3C)OC)C(C)C[C@@H]4CC[C@@H](CC(=O)Nc5ccc(CCCC(=O)OC)cc5)C(C4)OC)\C |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00054042 01005800 00900102 c0010700 203900c0 00002000 00000040 20000402 04000840 011808c8 08382004 5041f000 1602802a 00b08002 800a1448 00081008 10860000 02000100 1bc02000 00000201 40100120 18040e10 3300a080 00500018 10200401 80000000 00c04200 90000081 00008200 8006000b 24024000 00402e00 |