On Target CAH2_HUMAN 0.32142857/CHEMBL105637
For the given ligand Nai, we have found in our database that, being scored 0.32142857, the most similar ligand is CHEMBL105637. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL105637 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | NS(=O)(=O)c1ccc(CCCCCO)cc1 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000010 01801000 01000102 00b10200 00080008 00000000 00000000 00000000 00000800 00080840 08102000 60008000 00000000 00a00001 80200000 00080008 00000000 02000000 00402000 00002001 80000100 08040000 01000000 08400018 00000000 80000000 00000000 00000028 00000002 20020002 00000000 00010420 |