On Target ESR1_HUMAN 0.4871795/CHEMBL57150
For the given ligand Nai, we have found in our database that, being scored 0.4871795, the most similar ligand is CHEMBL57150. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL57150 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | OC[C@]12CC[C@H]([C@H](C1)C=CC2)c3ccc(O)cc3 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00000000 81000008 20000102 00110200 00080000 00000000 02000000 00000402 00000800 0018084a 08100000 40008000 00020002 00a00000 00000400 00080008 00000000 02000020 02402000 00022001 00000100 08000000 01008000 00400010 00200000 80000000 00524000 80000000 00000002 00020002 24020000 00010400 |