On Target MIF_HUMAN 0.24666667/CHEMBL2375653
For the given ligand Nai, we have found in our database that, being scored 0.24666667, the most similar ligand is CHEMBL2375653. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL2375653 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | C[C@H]1C[C@]23OC(=O)\C(=C/4\OC\C(=C/[C@H](O)C\C=C\C(=C\[C@@]2(C)C=C1C)\C)\C=C4)\C3=O |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 0005044a 81040000 00000900 90010301 400d0001 00200801 02000100 08011402 01000100 00108040 48000200 4040d091 94028008 20824000 02080405 0008100c 00820004 80000020 204d6090 0202a001 20002021 00005a00 0140a000 00000816 00201400 80001400 00407200 80000000 00004242 80000002 3682a000 06000010 |