On Target IKKB_HUMAN 0.3723404/CHEMBL1253688
For the given ligand Nai, we have found in our database that, being scored 0.3723404, the most similar ligand is CHEMBL1253688. Check out the elaboration below.
| Nai (Given Ligand) | CHEMBL1253688 (Similar Ligand) |
|---|---|
| C=C1/C=C\C=C/CC(=C)C1c2ccccc2 | O=C(CCc1ccccc1)\C=C\C[C@@H]2CC=CC(=O)O2 |
|
|
|
|
|
|
| 00000400 01040000 00000102 00110200 40010000 00800001 00000001 00000400 00000800 00180842 08100000 40408000 00020000 00200000 00000400 00000004 00000000 02100000 00002080 00000001 00002101 08000000 00008000 00400812 00000000 80002000 00404200 80000000 00000000 00020002 24800000 00010400 | 00040000 01000000 00000902 00010200 00000000 00000000 02000280 08000402 01000800 00180840 48100200 40009000 04028000 00200000 00000404 00080008 00020000 02000000 20010018 00008001 20000120 08001a80 0100a000 00400010 00201c00 80002400 00406200 80000000 00000200 00020002 04000000 00000410 |