On Target PERM_HUMAN 0.31543624/CHEMBL2347027
For the given ligand Beta M1, we have found in our database that, being scored 0.31543624, the most similar ligand is CHEMBL2347027. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL2347027 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | NC(=O)CCCCc1c[nH]c2c(F)cccc12 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00010002 01000800 00100102 46810610 00041100 00000010 00002000 00000000 00400800 000808c0 08100004 40019000 0d008808 00601800 00020040 00040004 00000000 02002080 00202400 00100001 40000100 18008618 20800000 80400010 00042000 80000000 08000000 00000001 00000002 00078002 00040a00 00000620 |