On Target PDE5A_HUMAN 0.36477986/CHEMBL544818
For the given ligand Beta M1, we have found in our database that, being scored 0.36477986, the most similar ligand is CHEMBL544818. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL544818 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | Cl.Cl.C(Cc1ccccc1)Nc2nc(nc3ccccc23)c4cccnc4 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00014002 00010000 80104100 18090610 21041020 00004000 00009000 00180800 10000100 10080840 09202004 40009010 04000800 00500000 00020040 020c0004 00040000 02007004 08600000 00600004 40100000 1824a028 20804040 81400011 00040002 80000000 08000000 000000a0 0440800c 00460402 40001800 200206c0 |