On Target COMT_HUMAN 0.33152175/CHEMBL3425740
For the given ligand Beta M1, we have found in our database that, being scored 0.33152175, the most similar ligand is CHEMBL3425740. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL3425740 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCCC(O)C1=CC(=O)C(=CN1c2cccc(c2)c3ccccc3)O |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0000200a 01000a08 60005102 10010610 00041428 04004004 15800000 00201100 02100b00 800808c0 08108004 40818000 00008805 00600200 00020040 020c000c 00028000 06804004 04600008 00060001 40000100 18008030 31800002 81500414 02042400 c0080040 08520260 000500c0 04404004 0a86000a c0040000 60200400 |