On Target SC6A4_HUMAN 0.49264705/CHEMBL486045
For the given ligand Beta M1, we have found in our database that, being scored 0.49264705, the most similar ligand is CHEMBL486045. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL486045 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CN[C@@H]1C[C@@H](Oc2ccccc2C)c3ccccc3C1 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 04000000 01000208 2010010a 00010700 00081020 02004400 02000000 00020001 00000900 000808c0 08300000 40808800 00800002 00210000 11000001 020c2008 00a00200 22008000 00c02000 00020001 00000d00 18200020 01004080 81c01010 00004000 80002201 00000000 10000000 04000303 0006000a 40000000 00000640 |