On Target MK01_HUMAN 0.35443038/CHEMBL1998121
For the given ligand Beta M1, we have found in our database that, being scored 0.35443038, the most similar ligand is CHEMBL1998121. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL1998121 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | NCCC(C(=O)Nc1ccc2[nH]ncc2c1)c3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0002c002 04000208 20100100 00010600 20040000 00002000 06000000 00000000 00200800 000808c0 08380004 40029800 07008026 00500000 c0020040 0004000c 00040000 02000008 08600000 00220405 40100100 1c200708 20802800 816c0011 00102000 80100000 00040000 10000080 04008000 0006000b 00002000 00024620 |