On Target HYES_HUMAN 0.4113475/CHEMBL471224
For the given ligand Beta M1, we have found in our database that, being scored 0.4113475, the most similar ligand is CHEMBL471224. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL471224 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | OC(C(=O)Nc1ccc(OCc2ccccc2)cc1)C34CC5CC(CC(C5)C3)C4 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 04014002 01000008 20101108 00010600 20081080 00006000 02000000 00000008 00000100 000008c0 00280004 4001d000 0480802a 00910000 01020041 02080008 00040000 02000000 0a402000 00020001 40100000 18000630 23002000 00d01010 00000000 80002000 08040000 10000080 00008200 00060001 40020000 00000200 |