On Target TRPV3_HUMAN 0.34502923/CHEMBL3696385
For the given ligand Beta M1, we have found in our database that, being scored 0.34502923, the most similar ligand is CHEMBL3696385. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL3696385 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CC(C)[C@H](CO)NCc1nc(ccc1F)C2CCc3ccccc3C2 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0200009a 01000000 00104102 16010e00 000400a1 00100022 01000010 02003001 00000800 00080840 08318004 40808000 00000802 00201200 00820420 020e010d 12008200 060020a2 00602008 00100241 40000100 18118000 23c04000 20400010 00100800 c0000001 00000040 80001081 00000106 00860002 20040880 20004700 |