On Target AOFA_HUMAN 0.47093022/CHEMBL2333936
For the given ligand Beta M1, we have found in our database that, being scored 0.47093022, the most similar ligand is CHEMBL2333936. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL2333936 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | C[C@H](Cc1ccc(OCCCCCCNc2c3CCCCc3nc4ccccc24)cc1)N(C)CC#C |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0400400a 01004008 6010410a 10810710 204c3120 02002040 0304a000 00100001 10400880 000808d0 08308004 40818000 00800802 00e00800 11120041 020c200e 00848200 06000004 08602408 00020201 44100100 18248018 21814000 81500010 00040000 80000001 08128040 10001080 04488206 00860002 000400a0 20000640 |