On Target ADRB2_HUMAN 0.56953645/CHEMBL2088197
For the given ligand Beta M1, we have found in our database that, being scored 0.56953645, the most similar ligand is CHEMBL2088197. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL2088197 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCc1cc2CC(Cc2cc1CC)NC[C@H](O)c3ccc(O)c4NC(=O)CCc34 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00004002 43000208 60100102 00010600 240010a1 40006042 03000000 00000001 00400980 000808d0 08380024 40809800 04008002 00301000 000a0040 020e4008 10048200 02000000 08000008 80020201 44100500 18200620 23006000 81408010 00040800 81000201 20520050 10801080 04428000 0006000b 40000400 20002600 |