On Target CASP1_HUMAN 0.36507937/CHEMBL114791
For the given ligand Beta M1, we have found in our database that, being scored 0.36507937, the most similar ligand is CHEMBL114791. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL114791 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | OC(=O)C[C@H](NC(=O)[C@@H]1Cc2cccc3CC[C@H](NC(=O)c4cccc5ccccc45)C(=O)N1c23)C=O |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0005c002 01003a00 00100122 04010600 20001001 00002040 03000000 2210100c 00100880 08090ac0 08380024 4001b000 0e008802 00302001 80020540 000c000a 00248000 02000001 08c00018 00000201 40100100 38368e08 21002083 8350001f 00001801 c0000080 00000010 90801080 0c088102 0006000b a0045080 20402600 |