On Target PDE4B_HUMAN 0.38690478/CHEMBL535714
For the given ligand Beta M1, we have found in our database that, being scored 0.38690478, the most similar ligand is CHEMBL535714. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL535714 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | FC(F)(F)c1ccc(c(NC(=O)C2(CC2)c3ccccc3)c1)n4cncn4 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00014006 00000808 40180100 00050600 64000040 0000e004 00008400 00101000 00400900 200808d0 0838000c 40009004 85008800 01100000 40060040 1008060c 08048000 02004000 08400000 00a00011 40100100 58208620 21006000 81400015 00040000 80000000 00008228 90000080 04408020 00461003 c0143000 00000780 |