On Target ACM4_HUMAN 0.4527027/CHEMBL1223805
For the given ligand Beta M1, we have found in our database that, being scored 0.4527027, the most similar ligand is CHEMBL1223805. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL1223805 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CO[C@@H]1CC[C@](C)(CC1)N2CCC(CC2)N3C(=O)Cc4ccc(C)cc34 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00004002 01001400 40100100 00010700 24180000 00000040 00000000 20000000 00000180 000809f0 08280004 50019800 01008002 00900000 40020140 0008000a 00848000 02000000 0a402000 00000201 60100400 18280610 21002000 81500019 00040000 80000200 00000210 10001080 04488200 00060013 00022000 20002e00 |