On Target TNFA_HUMAN 0.3398693/CHEMBL1569174
For the given ligand Beta M1, we have found in our database that, being scored 0.3398693, the most similar ligand is CHEMBL1569174. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL1569174 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCOC(=O)c1ccc(NC(=O)c2ccc(CN3CCc4ccccc4C3)cc2)cc1 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0000400a 00000800 00100100 d0090600 00000030 00004000 00000000 02001000 00000180 00080840 08280004 4000c000 80008882 00318000 00000440 02080008 00062200 02000020 08000000 00000200 40120000 18228e20 20016000 81400014 00000400 c0002000 00084000 80000080 04008300 00060003 e0040000 00000600 |