On Target BACE1_HUMAN 0.45810056/CHEMBL3979923
For the given ligand Beta M1, we have found in our database that, being scored 0.45810056, the most similar ligand is CHEMBL3979923. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL3979923 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | COC1CCC2(CC1)Cc3ccc(cc3C24NC(N)N(C)C4=O)N5CCC(F)(F)C5 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 1001400a 01000a00 4050010a 50010f00 20080020 08002012 00000004 02003001 00d00800 800808d0 09300004 4081b000 0500b88a 01e0b800 40020060 000e0408 00844218 02006000 0a402000 00000001 44120100 38218610 21004000 81700110 00050000 80000101 00000040 90048080 0c408302 0086000b 000e6000 80400600 |