On Target NEP_HUMAN 0.4108108/CHEMBL316595
For the given ligand Beta M1, we have found in our database that, being scored 0.4108108, the most similar ligand is CHEMBL316595. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL316595 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | OC(=O)[C@@H]1Cc2cccc3CCC(NC(=O)C4(S)Cc5ccccc5C4)C(=O)N1c23 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00014002 01007200 00101122 04110600 200010c1 00002040 83002000 2010010c 00100880 0b0f0ac0 08380024 4001b000 06008002 00343001 801a0140 020e000a 10248000 02000000 08400008 00000201 40100100 38240e00 23006041 8750001b 00000800 80000081 08000010 108010c0 0c088000 0006000b 20005080 23412600 |