On Target HPGDS_HUMAN 0.3236994/CHEMBL3425953
For the given ligand Beta M1, we have found in our database that, being scored 0.3236994, the most similar ligand is CHEMBL3425953. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL3425953 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | O=C(CCc1cccnc1)Nc2cncc(c2)c3cccc4[nH]ccc34 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00006002 00804a00 40104100 00810630 24041200 0c002018 00002000 00000000 00400800 400808d0 00380004 60009000 85008800 00700800 00020041 80040004 00060000 0200000c 0c200408 00000007 40100100 18028608 30802000 80400018 00041803 80180000 08000640 100000c0 00404000 0046000b 00040200 000006a0 |