On Target NK1R_HUMAN 0.5078125/CHEMBL121480
For the given ligand Beta M1, we have found in our database that, being scored 0.5078125, the most similar ligand is CHEMBL121480. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL121480 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | Cc1cc(C)cc(COC[C@@H](Nc2ccccc2)C(c3ccccc3)c4ccccc4)c1 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00004002 00000008 00101100 80010700 20000091 00004000 00000000 01000000 00000900 00080840 08341004 40008000 00000000 00010000 00021048 02081008 00040000 02000000 08400000 40000001 40100120 18200020 33000040 81400011 00000400 a0002000 08080000 40000080 04008280 00060002 40000004 02000600 |