On Target ALDR_HUMAN 0.32738096/CHEMBL240719
For the given ligand Beta M1, we have found in our database that, being scored 0.32738096, the most similar ligand is CHEMBL240719. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL240719 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | Cc1ccccc1CC(=O)Nc2cc(C)c(c(C)c2)S(=O)(=O)NCC(=O)O |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00004012 00802000 41100100 01b10600 24088031 00000008 00000000 00000008 00040000 00080850 08282004 6000b000 01008000 00300001 c0320040 00080008 00042280 02000000 08400000 00006400 c0140000 18200e01 22106000 c9400059 02042000 80000104 00000000 000000cc 04408400 20060003 00002000 00010660 |