On Target PGH1_SHEEP 0.3227848/CHEMBL3774442
For the given ligand Beta M1, we have found in our database that, being scored 0.3227848, the most similar ligand is CHEMBL3774442. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL3774442 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCCCCCOC(=O)Nc1cccc(c1)c2ccc(cc2F)C(C)C(=O)O |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00002002 01400000 00100100 02010700 04084040 00000010 00000000 80000000 00000304 00082850 08280004 50009800 01008000 00901100 40040040 00180008 08868200 02800000 0c402800 10400001 40000000 08000e10 31002002 00400010 00040004 80081002 80000200 000000c1 0040c200 80068003 00002000 00000600 |