On Target CNR1_HUMAN 0.4105263/CHEMBL2029735
For the given ligand Beta M1, we have found in our database that, being scored 0.4105263, the most similar ligand is CHEMBL2029735. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL2029735 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CN([C@H](CO)CCC(=O)NCCF)C(=O)c1ccc2c(c1)c3C[C@@H](CCc3n2C)C4CCOCC4 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0003000a 0100d800 00101102 50810710 800c51a1 00002042 01002000 22001101 00600900 800808c0 08308004 40839800 8c008822 01e08800 00020460 0a0c100c 10800200 86800004 00602408 00000201 40100120 18068618 23804000 8070041c 00042400 c0000001 08000040 90000080 00400306 00860043 a0060200 20800620 |