On Target MDR1_HUMAN 0.4551282/CHEMBL2074767
For the given ligand Beta M1, we have found in our database that, being scored 0.4551282, the most similar ligand is CHEMBL2074767. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL2074767 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCC1C[N+]2(CCCC3(C)N=N3)C4CC1C5C(O)C6(CC25)C4N(C)c7ccccc67 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00004002 01000200 00100122 04010e00 201800c0 00002040 03000000 20000000 00300800 00080ac0 08300004 50038000 00000002 01a02000 00560140 000c000a 18248000 02000000 08c02008 80000201 40100100 78200030 23000081 83500013 00000001 80000000 80000000 10001080 0c188002 0106100a 00020080 20002e00 |