On Target P2Y12_HUMAN 0.3478261/CHEMBL88708
For the given ligand Beta M1, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL88708. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL88708 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CN(C1CCCCC1)C(=O)CCCCc2ccc3[nH]c4nc(O)nc4cc3c2 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00014002 03005810 00184102 00010600 000c0040 0000c000 00008000 20000000 00400900 000808c0 08308004 40019000 0400880a 00e00000 60040140 000c000c 08000000 02000004 02202000 00000201 40020100 18048638 21800000 8050001c 00000000 80000000 00028040 10000000 00400002 00460003 c0040000 0c002680 |